C16H15NO5S — CID 957585
2-[(1R)-1-(4-methoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid (PubChem CID 957585) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-[(1R)-1-(4-methoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid.
| Compound Name | 2-[(1R)-1-(4-methoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 957585 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[(1R)-1-(4-methoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid |
| SMILES | COc1ccc([C@H](C[N+](=O)[O-])Sc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C16H15NO5S/c1-22-12-8-6-11(7-9-12)15(10-17(20)21)23-14-5-3-2-4-13(14)16(18)19/h2-9,15H,10H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | PCABBWMIUCUDMA-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|