C17H17NO6S — CID 4633894
2-[1-(2,4-dimethoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid (PubChem CID 4633894) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-[1-(2,4-dimethoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid.
| Compound Name | 2-[1-(2,4-dimethoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 4633894 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[1-(2,4-dimethoxyphenyl)-2-nitroethyl]sulfanylbenzoic acid |
| SMILES | COc1ccc(C(C[N+](=O)[O-])Sc2ccccc2C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C17H17NO6S/c1-23-11-7-8-12(14(9-11)24-2)16(10-18(21)22)25-15-6-4-3-5-13(15)17(19)20/h3-9,16H,10H2,1-2H3,(H,19,20) |
| InChIKey | ZTFXOAMKODSNMX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|