C16H18N2O4 — CID 94714144
2,4-dimethoxy-N-[(1R)-2-nitro-1-phenylethyl]aniline (PubChem CID 94714144) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(1R)-2-nitro-1-phenylethyl]aniline.
| Compound Name | 2,4-dimethoxy-N-[(1R)-2-nitro-1-phenylethyl]aniline |
|---|---|
| PubChem CID | 94714144 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2,4-dimethoxy-N-[(1R)-2-nitro-1-phenylethyl]aniline |
| SMILES | COc1ccc(N[C@@H](C[N+](=O)[O-])c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O4/c1-21-13-8-9-14(16(10-13)22-2)17-15(11-18(19)20)12-6-4-3-5-7-12/h3-10,15,17H,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | NJGQRYFDYCGPJV-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|