C27H22N2O3S — CID 102104922
(3R)-3-benzylsulfanyl-3-[(1S)-1-naphthalen-2-yl-2-nitroethyl]-1H-indol-2-one (PubChem CID 102104922) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is (3R)-3-benzylsulfanyl-3-[(1S)-1-naphthalen-2-yl-2-nitroethyl]-1H-indol-2-one.
| Compound Name | (3R)-3-benzylsulfanyl-3-[(1S)-1-naphthalen-2-yl-2-nitroethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 102104922 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (3R)-3-benzylsulfanyl-3-[(1S)-1-naphthalen-2-yl-2-nitroethyl]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2[C@]1(SCc1ccccc1)[C@H](C[N+](=O)[O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22N2O3S/c30-26-27(23-12-6-7-13-25(23)28-26,33-18-19-8-2-1-3-9-19)24(17-29(31)32)22-15-14-20-10-4-5-11-21(20)16-22/h1-16,24H,17-18H2,(H,28,30)/t24-,27+/m1/s1 |
| InChIKey | GBYVKSIWRKIOHJ-SQHAQQRYSA-N |
| XLogP | 5.98 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|