C19H22N2O4S2 — CID 54290827
[1-(3,4-dimethoxyphenyl)-2-nitroethyl] N-ethyl-N-phenylcarbamodithioate (PubChem CID 54290827) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-2-nitroethyl] N-ethyl-N-phenylcarbamodithioate.
| Compound Name | [1-(3,4-dimethoxyphenyl)-2-nitroethyl] N-ethyl-N-phenylcarbamodithioate |
|---|---|
| PubChem CID | 54290827 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-2-nitroethyl] N-ethyl-N-phenylcarbamodithioate |
| SMILES | CCN(C(=S)SC(C[N+](=O)[O-])c1ccc(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-4-20(15-8-6-5-7-9-15)19(26)27-18(13-21(22)23)14-10-11-16(24-2)17(12-14)25-3/h5-12,18H,4,13H2,1-3H3 |
| InChIKey | RXJRKXXTDUZMKE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|