C21H22N6O4S — CID 155127197
methyl 4-[[4-[2-nitro-1-(2,4,6-triaminopyrimidin-5-yl)ethyl]phenyl]sulfanylmethyl]benzoate (PubChem CID 155127197) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is methyl 4-[[4-[2-nitro-1-(2,4,6-triaminopyrimidin-5-yl)ethyl]phenyl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[4-[2-nitro-1-(2,4,6-triaminopyrimidin-5-yl)ethyl]phenyl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 155127197 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | methyl 4-[[4-[2-nitro-1-(2,4,6-triaminopyrimidin-5-yl)ethyl]phenyl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2ccc(C(C[N+](=O)[O-])c3c(N)nc(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C21H22N6O4S/c1-31-20(28)14-4-2-12(3-5-14)11-32-15-8-6-13(7-9-15)16(10-27(29)30)17-18(22)25-21(24)26-19(17)23/h2-9,16H,10-11H2,1H3,(H6,22,23,24,25,26) |
| InChIKey | CVUXRRHBSKQYTF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 173.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|