C12H12ClN5O3 — CID 135489101
2,4-diamino-5-[1-(4-chlorophenyl)-2-nitroethyl]-1H-pyrimidin-6-one (PubChem CID 135489101) has the molecular formula C12H12ClN5O3 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2,4-diamino-5-[1-(4-chlorophenyl)-2-nitroethyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-[1-(4-chlorophenyl)-2-nitroethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135489101 |
| Molecular Formula | C12H12ClN5O3 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2,4-diamino-5-[1-(4-chlorophenyl)-2-nitroethyl]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(C(C[N+](=O)[O-])c2ccc(Cl)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H12ClN5O3/c13-7-3-1-6(2-4-7)8(5-18(20)21)9-10(14)16-12(15)17-11(9)19/h1-4,8H,5H2,(H5,14,15,16,17,19) |
| InChIKey | XXDAXGPAWJWOMQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|