C15H18N4O3 — CID 135710988
4-[1-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)butyl]benzoic acid (PubChem CID 135710988) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[1-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)butyl]benzoic acid.
| Compound Name | 4-[1-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)butyl]benzoic acid |
|---|---|
| PubChem CID | 135710988 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-[1-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)butyl]benzoic acid |
| SMILES | CCCC(c1ccc(C(=O)O)cc1)c1c(N)nc(N)[nH]c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-2-3-10(8-4-6-9(7-5-8)14(21)22)11-12(16)18-15(17)19-13(11)20/h4-7,10H,2-3H2,1H3,(H,21,22)(H5,16,17,18,19,20) |
| InChIKey | LKZPCAWWPKLSTP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |