C21H30N4O5 — CID 135548178
ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4,4-diethoxybutyl]benzoate (PubChem CID 135548178) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4,4-diethoxybutyl]benzoate.
| Compound Name | ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4,4-diethoxybutyl]benzoate |
|---|---|
| PubChem CID | 135548178 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4,4-diethoxybutyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCC(c2c(N)nc(N)[nH]c2=O)C(OCC)OCC)cc1 |
| InChI | InChI=1S/C21H30N4O5/c1-4-28-19(27)14-10-7-13(8-11-14)9-12-15(20(29-5-2)30-6-3)16-17(22)24-21(23)25-18(16)26/h7-8,10-11,15,20H,4-6,9,12H2,1-3H3,(H5,22,23,24,25,26) |
| InChIKey | HFFNHNWVDRFSGA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|