C21H31N5O4 — CID 10454656
tert-butyl 4-[4,4-dimethoxy-3-(2,4,6-triaminopyrimidin-5-yl)butyl]benzoate (PubChem CID 10454656) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is tert-butyl 4-[4,4-dimethoxy-3-(2,4,6-triaminopyrimidin-5-yl)butyl]benzoate.
| Compound Name | tert-butyl 4-[4,4-dimethoxy-3-(2,4,6-triaminopyrimidin-5-yl)butyl]benzoate |
|---|---|
| PubChem CID | 10454656 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl 4-[4,4-dimethoxy-3-(2,4,6-triaminopyrimidin-5-yl)butyl]benzoate |
| SMILES | COC(OC)C(CCc1ccc(C(=O)OC(C)(C)C)cc1)c1c(N)nc(N)nc1N |
| InChI | InChI=1S/C21H31N5O4/c1-21(2,3)30-18(27)13-9-6-12(7-10-13)8-11-14(19(28-4)29-5)15-16(22)25-20(24)26-17(15)23/h6-7,9-10,14,19H,8,11H2,1-5H3,(H6,22,23,24,25,26) |
| InChIKey | YNRXTDBQDUETMA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 148.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|