C17H21N5O5 — CID 135440348
ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4-nitrobutyl]benzoate (PubChem CID 135440348) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4-nitrobutyl]benzoate.
| Compound Name | ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4-nitrobutyl]benzoate |
|---|---|
| PubChem CID | 135440348 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-4-nitrobutyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCC(C[N+](=O)[O-])c2c(N)nc(N)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H21N5O5/c1-2-27-16(24)11-6-3-10(4-7-11)5-8-12(9-22(25)26)13-14(18)20-17(19)21-15(13)23/h3-4,6-7,12H,2,5,8-9H2,1H3,(H5,18,19,20,21,23) |
| InChIKey | ACCKNCOTHFSBAG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 167.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|