C20H15F6NO6 — CID 102084485
(5R)-5-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-phenyl-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-one (PubChem CID 102084485) has the molecular formula C20H15F6NO6 and a molecular weight of 479.33 g/mol. Its IUPAC name is (5R)-5-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-phenyl-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-one.
| Compound Name | (5R)-5-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-phenyl-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 102084485 |
| Molecular Formula | C20H15F6NO6 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | (5R)-5-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-phenyl-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-one |
| SMILES | COc1cccc([C@H](C[N+](=O)[O-])[C@]2(c3ccccc3)OC(C(F)(F)F)(C(F)(F)F)OC2=O)c1 |
| InChI | InChI=1S/C20H15F6NO6/c1-31-14-9-5-6-12(10-14)15(11-27(29)30)17(13-7-3-2-4-8-13)16(28)32-18(33-17,19(21,22)23)20(24,25)26/h2-10,15H,11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | GGFFJBHIXPQNIN-RDJZCZTQSA-N |
| XLogP | 4.35 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|