C15H25N3O3 — CID 82020206
tert-butyl 4-[2-amino-1-(furan-2-yl)ethyl]piperazine-1-carboxylate (PubChem CID 82020206) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-1-(furan-2-yl)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-1-(furan-2-yl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 82020206 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl 4-[2-amino-1-(furan-2-yl)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(CN)c2ccco2)CC1 |
| InChI | InChI=1S/C15H25N3O3/c1-15(2,3)21-14(19)18-8-6-17(7-9-18)12(11-16)13-5-4-10-20-13/h4-5,10,12H,6-9,11,16H2,1-3H3 |
| InChIKey | ONCKAWYJIXBPDI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |