C14H22N2O3 — CID 81403373
tert-butyl 3-[[(1S)-1-(furan-2-yl)ethyl]amino]azetidine-1-carboxylate (PubChem CID 81403373) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 3-[[(1S)-1-(furan-2-yl)ethyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(1S)-1-(furan-2-yl)ethyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 81403373 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | tert-butyl 3-[[(1S)-1-(furan-2-yl)ethyl]amino]azetidine-1-carboxylate |
| SMILES | C[C@H](NC1CN(C(=O)OC(C)(C)C)C1)c1ccco1 |
| InChI | InChI=1S/C14H22N2O3/c1-10(12-6-5-7-18-12)15-11-8-16(9-11)13(17)19-14(2,3)4/h5-7,10-11,15H,8-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | DKHTXLQGWBTSQS-JTQLQIEISA-N |
| XLogP | 2.55 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |