C16H26N2O3 — CID 71633213
tert-butyl (3R)-3-[1-(furan-2-yl)ethyl-methylamino]pyrrolidine-1-carboxylate (PubChem CID 71633213) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is tert-butyl (3R)-3-[1-(furan-2-yl)ethyl-methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[1-(furan-2-yl)ethyl-methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71633213 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl (3R)-3-[1-(furan-2-yl)ethyl-methylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(c1ccco1)N(C)[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26N2O3/c1-12(14-7-6-10-20-14)17(5)13-8-9-18(11-13)15(19)21-16(2,3)4/h6-7,10,12-13H,8-9,11H2,1-5H3/t12?,13-/m1/s1 |
| InChIKey | CVAFLCJXRSDTSI-ZGTCLIOFSA-N |
| XLogP | 3.28 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |