C19H19N2O5S- — CID 6977645
2-[[2-[(3-methylphenyl)sulfonyl-prop-2-enylamino]benzoyl]amino]acetate (PubChem CID 6977645) has the molecular formula C19H19N2O5S- and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[[2-[(3-methylphenyl)sulfonyl-prop-2-enylamino]benzoyl]amino]acetate.
| Compound Name | 2-[[2-[(3-methylphenyl)sulfonyl-prop-2-enylamino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 6977645 |
| Molecular Formula | C19H19N2O5S- |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[[2-[(3-methylphenyl)sulfonyl-prop-2-enylamino]benzoyl]amino]acetate |
| SMILES | C=CCN(c1ccccc1C(=O)NCC(=O)[O-])S(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-3-11-21(27(25,26)15-8-6-7-14(2)12-15)17-10-5-4-9-16(17)19(24)20-13-18(22)23/h3-10,12H,1,11,13H2,2H3,(H,20,24)(H,22,23)/p-1 |
| InChIKey | MKHDFDPTASOLNI-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|