C19H16BrNO4S2 — CID 102125843
3-[(2-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 102125843) has the molecular formula C19H16BrNO4S2 and a molecular weight of 466.38 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102125843 |
| Molecular Formula | C19H16BrNO4S2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | 3-[(2-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2Br)c2ccsc2C(=O)O)cc1 |
| InChI | InChI=1S/C19H16BrNO4S2/c1-13-6-8-15(9-7-13)27(24,25)21(12-14-4-2-3-5-16(14)20)17-10-11-26-18(17)19(22)23/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | LKHCBRJFYGROOJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |