C23H29NO2SSi — CID 101488131
4-methyl-N-(3-methyl-1-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)benzenesulfonamide (PubChem CID 101488131) has the molecular formula C23H29NO2SSi and a molecular weight of 411.64 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-methyl-1-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 101488131 |
| Molecular Formula | C23H29NO2SSi |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-methyl-N-(3-methyl-1-phenylbut-3-enyl)-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| SMILES | C=C(C)CC(c1ccccc1)N(C#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29NO2SSi/c1-19(2)18-23(21-10-8-7-9-11-21)24(16-17-28(4,5)6)27(25,26)22-14-12-20(3)13-15-22/h7-15,23H,1,18H2,2-6H3 |
| InChIKey | BEXJXBMSKDFUQP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|