C24H22N2O3S — CID 102336617
4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N',4-diphenylbut-2-ynimidamide (PubChem CID 102336617) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N',4-diphenylbut-2-ynimidamide.
| Compound Name | 4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N',4-diphenylbut-2-ynimidamide |
|---|---|
| PubChem CID | 102336617 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N',4-diphenylbut-2-ynimidamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)/C(C#CC(O)c2ccccc2)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O3S/c1-19-13-15-22(16-14-19)30(28,29)26(2)24(25-21-11-7-4-8-12-21)18-17-23(27)20-9-5-3-6-10-20/h3-16,23,27H,1-2H3/b25-24+ |
| InChIKey | MPONOKVEINNFQH-OCOZRVBESA-N |
| XLogP | 4.08 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|