C24H21BrN2O3S — CID 102336619
4-(4-bromophenyl)-4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N'-phenylbut-2-ynimidamide (PubChem CID 102336619) has the molecular formula C24H21BrN2O3S and a molecular weight of 497.41 g/mol. Its IUPAC name is 4-(4-bromophenyl)-4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N'-phenylbut-2-ynimidamide.
| Compound Name | 4-(4-bromophenyl)-4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N'-phenylbut-2-ynimidamide |
|---|---|
| PubChem CID | 102336619 |
| Molecular Formula | C24H21BrN2O3S |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 4-(4-bromophenyl)-4-hydroxy-N-methyl-N-(4-methylphenyl)sulfonyl-N'-phenylbut-2-ynimidamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)/C(C#CC(O)c2ccc(Br)cc2)=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21BrN2O3S/c1-18-8-14-22(15-9-18)31(29,30)27(2)24(26-21-6-4-3-5-7-21)17-16-23(28)19-10-12-20(25)13-11-19/h3-15,23,28H,1-2H3/b26-24+ |
| InChIKey | VRUOYNVGHHRDAJ-SHHOIMCASA-N |
| XLogP | 4.85 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|