C23H27NO2SSi — CID 102343046
4-methyl-N-(4-phenylbuta-2,3-dienyl)-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide (PubChem CID 102343046) has the molecular formula C23H27NO2SSi and a molecular weight of 409.63 g/mol. Its IUPAC name is 4-methyl-N-(4-phenylbuta-2,3-dienyl)-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(4-phenylbuta-2,3-dienyl)-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102343046 |
| Molecular Formula | C23H27NO2SSi |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-methyl-N-(4-phenylbuta-2,3-dienyl)-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC#C[Si](C)(C)C)CC=C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO2SSi/c1-21-14-16-23(17-15-21)27(25,26)24(19-10-20-28(2,3)4)18-9-8-13-22-11-6-5-7-12-22/h5-7,9,11-17H,18-19H2,1-4H3 |
| InChIKey | BVFDVBHEVOFLFC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|