C29H27NO2S — CID 46176955
N-(5,5-diphenylpent-4-en-2-ynyl)-4-methyl-N-[(2E)-penta-2,4-dienyl]benzenesulfonamide (PubChem CID 46176955) has the molecular formula C29H27NO2S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-(5,5-diphenylpent-4-en-2-ynyl)-4-methyl-N-[(2E)-penta-2,4-dienyl]benzenesulfonamide.
| Compound Name | N-(5,5-diphenylpent-4-en-2-ynyl)-4-methyl-N-[(2E)-penta-2,4-dienyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46176955 |
| Molecular Formula | C29H27NO2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-(5,5-diphenylpent-4-en-2-ynyl)-4-methyl-N-[(2E)-penta-2,4-dienyl]benzenesulfonamide |
| SMILES | C=C/C=C/CN(CC#CC=C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H27NO2S/c1-3-4-12-23-30(33(31,32)28-21-19-25(2)20-22-28)24-13-11-18-29(26-14-7-5-8-15-26)27-16-9-6-10-17-27/h3-10,12,14-22H,1,23-24H2,2H3/b12-4+ |
| InChIKey | RBIOJJHRMZDJGP-UUILKARUSA-N |
| XLogP | 5.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|