C25H31NO4S2Si — CID 11627480
N-[3-(benzenesulfonyl)hexa-3,4-dienyl]-4-methyl-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide (PubChem CID 11627480) has the molecular formula C25H31NO4S2Si and a molecular weight of 501.75 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)hexa-3,4-dienyl]-4-methyl-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)hexa-3,4-dienyl]-4-methyl-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11627480 |
| Molecular Formula | C25H31NO4S2Si |
| Molecular Weight | 501.75 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-[3-(benzenesulfonyl)hexa-3,4-dienyl]-4-methyl-N-(3-trimethylsilylprop-2-ynyl)benzenesulfonamide |
| SMILES | CC=C=C(CCN(CC#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H31NO4S2Si/c1-6-11-23(31(27,28)24-12-8-7-9-13-24)18-20-26(19-10-21-33(3,4)5)32(29,30)25-16-14-22(2)15-17-25/h6-9,12-17H,18-20H2,1-5H3 |
| InChIKey | UNSPQYXMCPMSSI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|