C23H22INO3S — CID 46930946
N-[2-[2-(2-iodoethynyl)phenyl]ethynyl]-4-methyl-N-(6-oxohexyl)benzenesulfonamide (PubChem CID 46930946) has the molecular formula C23H22INO3S and a molecular weight of 519.40 g/mol. Its IUPAC name is N-[2-[2-(2-iodoethynyl)phenyl]ethynyl]-4-methyl-N-(6-oxohexyl)benzenesulfonamide.
| Compound Name | N-[2-[2-(2-iodoethynyl)phenyl]ethynyl]-4-methyl-N-(6-oxohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46930946 |
| Molecular Formula | C23H22INO3S |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | N-[2-[2-(2-iodoethynyl)phenyl]ethynyl]-4-methyl-N-(6-oxohexyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#Cc2ccccc2C#CI)CCCCCC=O)cc1 |
| InChI | InChI=1S/C23H22INO3S/c1-20-10-12-23(13-11-20)29(27,28)25(17-6-2-3-7-19-26)18-15-22-9-5-4-8-21(22)14-16-24/h4-5,8-13,19H,2-3,6-7,17H2,1H3 |
| InChIKey | SPCOXBHLKIFMTC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|