C37H53N5O6S2 — CID 23242802
N-[4-[3-[benzyl-[3-[4-formamidobutyl-(4-methylphenyl)sulfonylamino]propyl]amino]propyl-(4-methylphenyl)sulfonylamino]butyl]formamide (PubChem CID 23242802) has the molecular formula C37H53N5O6S2 and a molecular weight of 727.99 g/mol. Its IUPAC name is N-[4-[3-[benzyl-[3-[4-formamidobutyl-(4-methylphenyl)sulfonylamino]propyl]amino]propyl-(4-methylphenyl)sulfonylamino]butyl]formamide.
| Compound Name | N-[4-[3-[benzyl-[3-[4-formamidobutyl-(4-methylphenyl)sulfonylamino]propyl]amino]propyl-(4-methylphenyl)sulfonylamino]butyl]formamide |
|---|---|
| PubChem CID | 23242802 |
| Molecular Formula | C37H53N5O6S2 |
| Molecular Weight | 727.99 g/mol |
| Exact Mass | 727.34 |
| IUPAC Name | N-[4-[3-[benzyl-[3-[4-formamidobutyl-(4-methylphenyl)sulfonylamino]propyl]amino]propyl-(4-methylphenyl)sulfonylamino]butyl]formamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCCNC=O)CCCN(CCCN(CCCCNC=O)S(=O)(=O)c2ccc(C)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C37H53N5O6S2/c1-33-14-18-36(19-15-33)49(45,46)41(26-8-6-22-38-31-43)28-10-24-40(30-35-12-4-3-5-13-35)25-11-29-42(27-9-7-23-39-32-44)50(47,48)37-20-16-34(2)17-21-37/h3-5,12-21,31-32H,6-11,22-30H2,1-2H3,(H,38,43)(H,39,44) |
| InChIKey | PMVRKZBTWWCGLN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.99 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|