C26H31NO2SSi — CID 10551502
N-benzyl-N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 10551502) has the molecular formula C26H31NO2SSi and a molecular weight of 449.69 g/mol. Its IUPAC name is N-benzyl-N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10551502 |
| Molecular Formula | C26H31NO2SSi |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-benzyl-N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | C/C=C(/CN(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H31NO2SSi/c1-5-25(31(3,4)26-14-10-7-11-15-26)21-27(20-23-12-8-6-9-13-23)30(28,29)24-18-16-22(2)17-19-24/h5-19H,20-21H2,1-4H3/b25-5- |
| InChIKey | NYIWNRFAXMESEF-FISMNSNESA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|