C21H32FNO2S — CID 16723589
N-(2-fluoroprop-2-enyl)-4-methyl-N-undec-10-enylbenzenesulfonamide (PubChem CID 16723589) has the molecular formula C21H32FNO2S and a molecular weight of 381.56 g/mol. Its IUPAC name is N-(2-fluoroprop-2-enyl)-4-methyl-N-undec-10-enylbenzenesulfonamide.
| Compound Name | N-(2-fluoroprop-2-enyl)-4-methyl-N-undec-10-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 16723589 |
| Molecular Formula | C21H32FNO2S |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(2-fluoroprop-2-enyl)-4-methyl-N-undec-10-enylbenzenesulfonamide |
| SMILES | C=CCCCCCCCCCN(CC(=C)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H32FNO2S/c1-4-5-6-7-8-9-10-11-12-17-23(18-20(3)22)26(24,25)21-15-13-19(2)14-16-21/h4,13-16H,1,3,5-12,17-18H2,2H3 |
| InChIKey | DULWHRJJCZJFGT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|