C15H20N2O6S — CID 11111061
ethyl 2-[(4-nitrophenyl)sulfonyl-pent-4-enylamino]acetate (PubChem CID 11111061) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is ethyl 2-[(4-nitrophenyl)sulfonyl-pent-4-enylamino]acetate.
| Compound Name | ethyl 2-[(4-nitrophenyl)sulfonyl-pent-4-enylamino]acetate |
|---|---|
| PubChem CID | 11111061 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | ethyl 2-[(4-nitrophenyl)sulfonyl-pent-4-enylamino]acetate |
| SMILES | C=CCCCN(CC(=O)OCC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N2O6S/c1-3-5-6-11-16(12-15(18)23-4-2)24(21,22)14-9-7-13(8-10-14)17(19)20/h3,7-10H,1,4-6,11-12H2,2H3 |
| InChIKey | FZTHSIWKUXVVEM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|