C19H28N2O6S — CID 142602137
dec-9-enyl 2-[(4-nitrophenyl)sulfonyl-(trideuteriomethyl)amino]acetate (PubChem CID 142602137) has the molecular formula C19H28N2O6S and a molecular weight of 415.53 g/mol. Its IUPAC name is dec-9-enyl 2-[(4-nitrophenyl)sulfonyl-(trideuteriomethyl)amino]acetate.
| Compound Name | dec-9-enyl 2-[(4-nitrophenyl)sulfonyl-(trideuteriomethyl)amino]acetate |
|---|---|
| PubChem CID | 142602137 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | dec-9-enyl 2-[(4-nitrophenyl)sulfonyl-(trideuteriomethyl)amino]acetate |
| SMILES | [2H]C([2H])([2H])N(CC(=O)OCCCCCCCCC=C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H28N2O6S/c1-3-4-5-6-7-8-9-10-15-27-19(22)16-20(2)28(25,26)18-13-11-17(12-14-18)21(23)24/h3,11-14H,1,4-10,15-16H2,2H3/i2D3 |
| InChIKey | GFSOFCXINDQWDO-BMSJAHLVSA-N |
| XLogP | 3.68 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|