C14H18N2O6S — CID 170207075
pent-4-en-2-yl 2-[methyl-(4-nitrophenyl)sulfonylamino]acetate (PubChem CID 170207075) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is pent-4-en-2-yl 2-[methyl-(4-nitrophenyl)sulfonylamino]acetate.
| Compound Name | pent-4-en-2-yl 2-[methyl-(4-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 170207075 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | pent-4-en-2-yl 2-[methyl-(4-nitrophenyl)sulfonylamino]acetate |
| SMILES | C=CCC(C)OC(=O)CN(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O6S/c1-4-5-11(2)22-14(17)10-15(3)23(20,21)13-8-6-12(7-9-13)16(18)19/h4,6-9,11H,1,5,10H2,2-3H3 |
| InChIKey | IVJKHTSIXWPYMW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|