C19H29N5O6S — CID 142602232
[(2R,3S)-3-methyloct-7-en-2-yl] 2-[[2-(diaminomethylideneamino)-4-nitrophenyl]sulfonyl-(trideuteriomethyl)amino]acetate (PubChem CID 142602232) has the molecular formula C19H29N5O6S and a molecular weight of 458.56 g/mol. Its IUPAC name is [(2R,3S)-3-methyloct-7-en-2-yl] 2-[[2-(diaminomethylideneamino)-4-nitrophenyl]sulfonyl-(trideuteriomethyl)amino]acetate.
| Compound Name | [(2R,3S)-3-methyloct-7-en-2-yl] 2-[[2-(diaminomethylideneamino)-4-nitrophenyl]sulfonyl-(trideuteriomethyl)amino]acetate |
|---|---|
| PubChem CID | 142602232 |
| Molecular Formula | C19H29N5O6S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | [(2R,3S)-3-methyloct-7-en-2-yl] 2-[[2-(diaminomethylideneamino)-4-nitrophenyl]sulfonyl-(trideuteriomethyl)amino]acetate |
| SMILES | [2H]C([2H])([2H])N(CC(=O)O[C@H](C)[C@@H](C)CCCC=C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1N=C(N)N |
| InChI | InChI=1S/C19H29N5O6S/c1-5-6-7-8-13(2)14(3)30-18(25)12-23(4)31(28,29)17-10-9-15(24(26)27)11-16(17)22-19(20)21/h5,9-11,13-14H,1,6-8,12H2,2-4H3,(H4,20,21,22)/t13-,14+/m0/s1/i4D3 |
| InChIKey | NCYABEVRSXDONX-CHOGLPGPSA-N |
| XLogP | 2.04 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|