C29H33BF4O3S3 — CID 171622808
10-thianthren-5-ium-5-yldec-9-enyl 4-methylbenzenesulfonate tetrafluoroborate (PubChem CID 171622808) has the molecular formula C29H33BF4O3S3 and a molecular weight of 612.59 g/mol. Its IUPAC name is 10-thianthren-5-ium-5-yldec-9-enyl 4-methylbenzenesulfonate tetrafluoroborate.
| Compound Name | 10-thianthren-5-ium-5-yldec-9-enyl 4-methylbenzenesulfonate tetrafluoroborate |
|---|---|
| PubChem CID | 171622808 |
| Molecular Formula | C29H33BF4O3S3 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | 10-thianthren-5-ium-5-yldec-9-enyl 4-methylbenzenesulfonate tetrafluoroborate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCCC=C[S+]2c3ccccc3Sc3ccccc32)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C29H33O3S3.BF4/c1-24-18-20-25(21-19-24)35(30,31)32-22-12-6-4-2-3-5-7-13-23-34-28-16-10-8-14-26(28)33-27-15-9-11-17-29(27)34;2-1(3,4)5/h8-11,13-21,23H,2-7,12,22H2,1H3;/q+1;-1 |
| InChIKey | WSKURFUEBQZLML-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|