C35H54O2Si — CID 70879858
hydroxy-(2-methyl-13-nonoxytridec-10-yn-2-yl)-diphenylsilane (PubChem CID 70879858) has the molecular formula C35H54O2Si and a molecular weight of 534.90 g/mol. Its IUPAC name is hydroxy-(2-methyl-13-nonoxytridec-10-yn-2-yl)-diphenylsilane.
| Compound Name | hydroxy-(2-methyl-13-nonoxytridec-10-yn-2-yl)-diphenylsilane |
|---|---|
| PubChem CID | 70879858 |
| Molecular Formula | C35H54O2Si |
| Molecular Weight | 534.90 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | hydroxy-(2-methyl-13-nonoxytridec-10-yn-2-yl)-diphenylsilane |
| SMILES | CCCCCCCCCOCCC#CCCCCCCCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H54O2Si/c1-4-5-6-7-12-15-24-31-37-32-25-16-13-10-8-9-11-14-23-30-35(2,3)38(36,33-26-19-17-20-27-33)34-28-21-18-22-29-34/h17-22,26-29,36H,4-12,14-15,23-25,30-32H2,1-3H3 |
| InChIKey | WVGCUBNPNPYUNA-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.90 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|