C22H31NOSi — CID 171400301
hydroxy-(2-methyl-4-piperidin-4-ylbutan-2-yl)-diphenylsilane (PubChem CID 171400301) has the molecular formula C22H31NOSi and a molecular weight of 353.58 g/mol. Its IUPAC name is hydroxy-(2-methyl-4-piperidin-4-ylbutan-2-yl)-diphenylsilane.
| Compound Name | hydroxy-(2-methyl-4-piperidin-4-ylbutan-2-yl)-diphenylsilane |
|---|---|
| PubChem CID | 171400301 |
| Molecular Formula | C22H31NOSi |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | hydroxy-(2-methyl-4-piperidin-4-ylbutan-2-yl)-diphenylsilane |
| SMILES | CC(C)(CCC1CCNCC1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31NOSi/c1-22(2,16-13-19-14-17-23-18-15-19)25(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,19,23-24H,13-18H2,1-2H3 |
| InChIKey | WSIJZSQHNYMMAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|