C16H29N3 — CID 158253019
N-benzyl-2-methylpropan-2-amine;piperidin-4-amine (PubChem CID 158253019) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N-benzyl-2-methylpropan-2-amine;piperidin-4-amine.
| Compound Name | N-benzyl-2-methylpropan-2-amine;piperidin-4-amine |
|---|---|
| PubChem CID | 158253019 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N-benzyl-2-methylpropan-2-amine;piperidin-4-amine |
| SMILES | CC(C)(C)NCc1ccccc1.NC1CCNCC1 |
| InChI | InChI=1S/C11H17N.C5H12N2/c1-11(2,3)12-9-10-7-5-4-6-8-10;6-5-1-3-7-4-2-5/h4-8,12H,9H2,1-3H3;5,7H,1-4,6H2 |
| InChIKey | GGYFTZYTDWNKDO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |