C12H22N4 — CID 161475592
N-benzyl-2-methylpropan-2-amine;guanidine (PubChem CID 161475592) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-benzyl-2-methylpropan-2-amine;guanidine.
| Compound Name | N-benzyl-2-methylpropan-2-amine;guanidine |
|---|---|
| PubChem CID | 161475592 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-benzyl-2-methylpropan-2-amine;guanidine |
| SMILES | CC(C)(C)NCc1ccccc1.[H]N=C(N)N |
| InChI | InChI=1S/C11H17N.CH5N3/c1-11(2,3)12-9-10-7-5-4-6-8-10;2-1(3)4/h4-8,12H,9H2,1-3H3;(H5,2,3,4) |
| InChIKey | WDRAJRXXMQELLO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|