C29H42O3Si — CID 70903447
hydroxy-[(7S)-8-[(2R)-6-(methoxymethyl)-3,6-dihydro-2H-pyran-2-yl]-2,7-dimethyloctan-2-yl]-diphenylsilane (PubChem CID 70903447) has the molecular formula C29H42O3Si and a molecular weight of 466.74 g/mol. Its IUPAC name is hydroxy-[(7S)-8-[(2R)-6-(methoxymethyl)-3,6-dihydro-2H-pyran-2-yl]-2,7-dimethyloctan-2-yl]-diphenylsilane.
| Compound Name | hydroxy-[(7S)-8-[(2R)-6-(methoxymethyl)-3,6-dihydro-2H-pyran-2-yl]-2,7-dimethyloctan-2-yl]-diphenylsilane |
|---|---|
| PubChem CID | 70903447 |
| Molecular Formula | C29H42O3Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | hydroxy-[(7S)-8-[(2R)-6-(methoxymethyl)-3,6-dihydro-2H-pyran-2-yl]-2,7-dimethyloctan-2-yl]-diphenylsilane |
| SMILES | COCC1C=CC[C@@H](C[C@@H](C)CCCCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C29H42O3Si/c1-24(22-25-15-13-16-26(32-25)23-31-4)14-11-12-21-29(2,3)33(30,27-17-7-5-8-18-27)28-19-9-6-10-20-28/h5-10,13,16-20,24-26,30H,11-12,14-15,21-23H2,1-4H3/t24-,25-,26?/m0/s1 |
| InChIKey | BDRWCYNOMUFRDS-NPGWBMRXSA-N |
| XLogP | 5.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|