C31H48O6Si — CID 71103971
(3R,6S)-4,5-dibutoxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-6-methoxyoxan-3-ol (PubChem CID 71103971) has the molecular formula C31H48O6Si and a molecular weight of 544.81 g/mol. Its IUPAC name is (3R,6S)-4,5-dibutoxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-6-methoxyoxan-3-ol.
| Compound Name | (3R,6S)-4,5-dibutoxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-6-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 71103971 |
| Molecular Formula | C31H48O6Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (3R,6S)-4,5-dibutoxy-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-6-methoxyoxan-3-ol |
| SMILES | CCCCOC1C(OCCCC)[C@H](O)C(CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O[C@@H]1OC |
| InChI | InChI=1S/C31H48O6Si/c1-6-8-22-35-28-27(32)26(37-30(34-5)29(28)36-23-9-7-2)20-21-31(3,4)38(33,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,26-30,32-33H,6-9,20-23H2,1-5H3/t26?,27-,28?,29?,30+/m1/s1 |
| InChIKey | UESCACVRXTZVIU-SKFMPKQFSA-N |
| XLogP | 4.40 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|