C27H36O2Si — CID 170737732
tert-butyl-[[4-(2-methoxyethenyl)-1-bicyclo[2.2.1]heptanyl]methoxy]-diphenylsilane (PubChem CID 170737732) has the molecular formula C27H36O2Si and a molecular weight of 420.67 g/mol. Its IUPAC name is tert-butyl-[[4-(2-methoxyethenyl)-1-bicyclo[2.2.1]heptanyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[4-(2-methoxyethenyl)-1-bicyclo[2.2.1]heptanyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 170737732 |
| Molecular Formula | C27H36O2Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | tert-butyl-[[4-(2-methoxyethenyl)-1-bicyclo[2.2.1]heptanyl]methoxy]-diphenylsilane |
| SMILES | COC=CC12CCC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)(CC1)C2 |
| InChI | InChI=1S/C27H36O2Si/c1-25(2,3)30(23-11-7-5-8-12-23,24-13-9-6-10-14-24)29-22-27-17-15-26(21-27,16-18-27)19-20-28-4/h5-14,19-20H,15-18,21-22H2,1-4H3 |
| InChIKey | CWIMNUROOYSHPH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|