C35H53NO4SSi — CID 50922998
1-[(1S,4S,8S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,6-dioxo-6λ6-thia-5-azatricyclo[6.4.0.01,5]dodecan-7-yl]octan-2-ol (PubChem CID 50922998) has the molecular formula C35H53NO4SSi and a molecular weight of 611.97 g/mol. Its IUPAC name is 1-[(1S,4S,8S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,6-dioxo-6λ6-thia-5-azatricyclo[6.4.0.01,5]dodecan-7-yl]octan-2-ol.
| Compound Name | 1-[(1S,4S,8S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,6-dioxo-6λ6-thia-5-azatricyclo[6.4.0.01,5]dodecan-7-yl]octan-2-ol |
|---|---|
| PubChem CID | 50922998 |
| Molecular Formula | C35H53NO4SSi |
| Molecular Weight | 611.97 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 1-[(1S,4S,8S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,6-dioxo-6λ6-thia-5-azatricyclo[6.4.0.01,5]dodecan-7-yl]octan-2-ol |
| SMILES | CCCCCCC(O)CC1[C@H]2CCCC[C@]23CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N3S1(=O)=O |
| InChI | InChI=1S/C35H53NO4SSi/c1-5-6-7-10-17-29(37)26-33-32-22-15-16-24-35(32)25-23-28(36(35)41(33,38)39)27-40-42(34(2,3)4,30-18-11-8-12-19-30)31-20-13-9-14-21-31/h8-9,11-14,18-21,28-29,32-33,37H,5-7,10,15-17,22-27H2,1-4H3/t28-,29?,32+,33?,35-/m0/s1 |
| InChIKey | XCXXCUUIFIAJTN-DJHVSQNKSA-N |
| XLogP | 6.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.97 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|