C26H39NO3 — CID 122205149
methyl (3S,5S,8R,8aS)-8-ethenyl-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate (PubChem CID 122205149) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is methyl (3S,5S,8R,8aS)-8-ethenyl-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate.
| Compound Name | methyl (3S,5S,8R,8aS)-8-ethenyl-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate |
|---|---|
| PubChem CID | 122205149 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | methyl (3S,5S,8R,8aS)-8-ethenyl-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate |
| SMILES | C=C[C@H]1CC[C@H](CCCCCC)N2[C@H](COCc3ccccc3)CC[C@@]12C(=O)OC |
| InChI | InChI=1S/C26H39NO3/c1-4-6-7-11-14-23-16-15-22(5-2)26(25(28)29-3)18-17-24(27(23)26)20-30-19-21-12-9-8-10-13-21/h5,8-10,12-13,22-24H,2,4,6-7,11,14-20H2,1,3H3/t22-,23-,24-,26-/m0/s1 |
| InChIKey | LXNCNFXXFWTKHO-IGRGDXOOSA-N |
| XLogP | 5.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|