C21H35NO3 — CID 72762026
(5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl)methyl acetate (PubChem CID 72762026) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl)methyl acetate.
| Compound Name | (5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl)methyl acetate |
|---|---|
| PubChem CID | 72762026 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl)methyl acetate |
| SMILES | CCCCCCC1CC(=O)C2CCCCC23CCC(COC(C)=O)N13 |
| InChI | InChI=1S/C21H35NO3/c1-3-4-5-6-9-17-14-20(24)19-10-7-8-12-21(19)13-11-18(22(17)21)15-25-16(2)23/h17-19H,3-15H2,1-2H3 |
| InChIKey | WENCIPPGJFUDAM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|