C25H45NO3Si — CID 10646554
2-trimethylsilylethyl (2S,4aS,8aR)-8a-but-3-enyl-2-hexyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate (PubChem CID 10646554) has the molecular formula C25H45NO3Si and a molecular weight of 435.73 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,4aS,8aR)-8a-but-3-enyl-2-hexyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2S,4aS,8aR)-8a-but-3-enyl-2-hexyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 10646554 |
| Molecular Formula | C25H45NO3Si |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 2-trimethylsilylethyl (2S,4aS,8aR)-8a-but-3-enyl-2-hexyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate |
| SMILES | C=CCC[C@]12CCCC[C@@H]1C(=O)C[C@H](CCCCCC)N2C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C25H45NO3Si/c1-6-8-10-11-14-21-20-23(27)22-15-12-13-17-25(22,16-9-7-2)26(21)24(28)29-18-19-30(3,4)5/h7,21-22H,2,6,8-20H2,1,3-5H3/t21-,22+,25-/m0/s1 |
| InChIKey | KGYIRZOBWPQXAY-FBLLAGFSSA-N |
| XLogP | 6.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|