About octyl 2-trimethylsilylethyl carbonate
octyl 2-trimethylsilylethyl carbonate (PubChem CID 172701355) has the molecular formula C14H30O3Si
and a molecular weight of 274.48 g/mol. Its IUPAC name is octyl 2-trimethylsilylethyl carbonate.
Molecular Properties
| Compound Name | octyl 2-trimethylsilylethyl carbonate |
| PubChem CID | 172701355 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | octyl 2-trimethylsilylethyl carbonate |
| SMILES | CCCCCCCCOC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-5-6-7-8-9-10-11-16-14(15)17-12-13-18(2,3)4/h5-13H2,1-4H3 |
| InChIKey | CZWHHNGHOQREAG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octyl 2-trimethylsilylethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 2-trimethylsilylethyl carbonate?
The IUPAC name of octyl 2-trimethylsilylethyl carbonate (CID 172701355) is octyl 2-trimethylsilylethyl carbonate.
What is the SMILES notation for octyl 2-trimethylsilylethyl carbonate?
The canonical SMILES for octyl 2-trimethylsilylethyl carbonate is CCCCCCCCOC(=O)OCC[Si](C)(C)C.
What is the InChIKey of octyl 2-trimethylsilylethyl carbonate?
The InChIKey is CZWHHNGHOQREAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3Si/c1-5-6-7-8-9-10-11-16-14(15)17-12-13-18(2,3)4/h5-13H2,1-4H3.
What are the key properties of octyl 2-trimethylsilylethyl carbonate?
octyl 2-trimethylsilylethyl carbonate has a molecular weight of 274.48 g/mol, XLogP of 4.84, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 2-trimethylsilylethyl carbonate is sourced from PubChem (CID 172701355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).