About 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate
2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate (PubChem CID 87902808) has the molecular formula C14H32O2Si2
and a molecular weight of 288.58 g/mol. Its IUPAC name is 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate |
| PubChem CID | 87902808 |
| Molecular Formula | C14H32O2Si2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate |
| SMILES | CCCCCC[Si](C)(C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C14H32O2Si2/c1-7-8-9-10-12-18(5,6)14(15)16-11-13-17(2,3)4/h7-13H2,1-6H3 |
| InChIKey | LQMQVMMANOETDM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate?
The IUPAC name of 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate (CID 87902808) is 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate.
What is the SMILES notation for 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate?
The canonical SMILES for 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate is CCCCCC[Si](C)(C)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate?
The InChIKey is LQMQVMMANOETDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O2Si2/c1-7-8-9-10-12-18(5,6)14(15)16-11-13-17(2,3)4/h7-13H2,1-6H3.
What are the key properties of 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate?
2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate has a molecular weight of 288.58 g/mol, XLogP of 5.33, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl [hexyl(dimethyl)silyl]formate is sourced from PubChem (CID 87902808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).