About 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate
2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate (PubChem CID 140870286) has the molecular formula C19H37NO3Si
and a molecular weight of 355.60 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate |
| PubChem CID | 140870286 |
| Molecular Formula | C19H37NO3Si |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate |
| SMILES | C/C=C(\NC(=O)OCC[Si](C)(C)C)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C19H37NO3Si/c1-6-8-9-10-11-12-13-14-18(21)17(7-2)20-19(22)23-15-16-24(3,4)5/h7H,6,8-16H2,1-5H3,(H,20,22)/b17-7- |
| InChIKey | OSIICGDANIGWIF-IDUWFGFVSA-N |
| XLogP | 5.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate?
The IUPAC name of 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate (CID 140870286) is 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate.
What is the SMILES notation for 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate?
The canonical SMILES for 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate is C/C=C(\NC(=O)OCC[Si](C)(C)C)C(=O)CCCCCCCCC.
What is the InChIKey of 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate?
The InChIKey is OSIICGDANIGWIF-IDUWFGFVSA-N. The full InChI is InChI=1S/C19H37NO3Si/c1-6-8-9-10-11-12-13-14-18(21)17(7-2)20-19(22)23-15-16-24(3,4)5/h7H,6,8-16H2,1-5H3,(H,20,22)/b17-7-.
What are the key properties of 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate?
2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate has a molecular weight of 355.60 g/mol, XLogP of 5.66, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate is sourced from PubChem (CID 140870286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).