C14H29NO4Si — CID 162340818
(2S)-2-(2-trimethylsilylethoxycarbonylamino)octanoic acid (PubChem CID 162340818) has the molecular formula C14H29NO4Si and a molecular weight of 303.48 g/mol. Its IUPAC name is (2S)-2-(2-trimethylsilylethoxycarbonylamino)octanoic acid.
| Compound Name | (2S)-2-(2-trimethylsilylethoxycarbonylamino)octanoic acid |
|---|---|
| PubChem CID | 162340818 |
| Molecular Formula | C14H29NO4Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2S)-2-(2-trimethylsilylethoxycarbonylamino)octanoic acid |
| SMILES | CCCCCC[C@H](NC(=O)OCC[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H29NO4Si/c1-5-6-7-8-9-12(13(16)17)15-14(18)19-10-11-20(2,3)4/h12H,5-11H2,1-4H3,(H,15,18)(H,16,17)/t12-/m0/s1 |
| InChIKey | VOICYURRDKXVGY-LBPRGKRZSA-N |
| XLogP | 3.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|