C19H32ClNO — CID 10758459
(2S,4aR,8aR)-8a-but-3-enyl-1-chloro-2-hexyl-3,4a,5,6,7,8-hexahydro-2H-quinolin-4-one (PubChem CID 10758459) has the molecular formula C19H32ClNO and a molecular weight of 325.92 g/mol. Its IUPAC name is (2S,4aR,8aR)-8a-but-3-enyl-1-chloro-2-hexyl-3,4a,5,6,7,8-hexahydro-2H-quinolin-4-one.
| Compound Name | (2S,4aR,8aR)-8a-but-3-enyl-1-chloro-2-hexyl-3,4a,5,6,7,8-hexahydro-2H-quinolin-4-one |
|---|---|
| PubChem CID | 10758459 |
| Molecular Formula | C19H32ClNO |
| Molecular Weight | 325.92 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (2S,4aR,8aR)-8a-but-3-enyl-1-chloro-2-hexyl-3,4a,5,6,7,8-hexahydro-2H-quinolin-4-one |
| SMILES | C=CCC[C@]12CCCC[C@H]1C(=O)C[C@H](CCCCCC)N2Cl |
| InChI | InChI=1S/C19H32ClNO/c1-3-5-7-8-11-16-15-18(22)17-12-9-10-14-19(17,21(16)20)13-6-4-2/h4,16-17H,2-3,5-15H2,1H3/t16-,17-,19-/m0/s1 |
| InChIKey | FUKLTONOFGRIAH-LNLFQRSKSA-N |
| XLogP | 5.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.92 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|