C20H32N2OS — CID 22832878
[(3R,5S,11aR)-5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl]methyl thiocyanate (PubChem CID 22832878) has the molecular formula C20H32N2OS and a molecular weight of 348.56 g/mol. Its IUPAC name is [(3R,5S,11aR)-5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl]methyl thiocyanate.
| Compound Name | [(3R,5S,11aR)-5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 22832878 |
| Molecular Formula | C20H32N2OS |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [(3R,5S,11aR)-5-hexyl-7-oxo-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-yl]methyl thiocyanate |
| SMILES | CCCCCC[C@H]1CC(=O)C2CCCC[C@@]23CC[C@H](CSC#N)N13 |
| InChI | InChI=1S/C20H32N2OS/c1-2-3-4-5-8-16-13-19(23)18-9-6-7-11-20(18)12-10-17(22(16)20)14-24-15-21/h16-18H,2-14H2,1H3/t16-,17+,18?,20+/m0/s1 |
| InChIKey | QWOZNKGCXULCKK-GFIMQBJWSA-N |
| XLogP | 4.91 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|