C25H46BNO3 — CID 134974553
[(3R,5S,7R,7aS,11aR)-5-hexyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol (PubChem CID 134974553) has the molecular formula C25H46BNO3 and a molecular weight of 419.46 g/mol. Its IUPAC name is [(3R,5S,7R,7aS,11aR)-5-hexyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol.
| Compound Name | [(3R,5S,7R,7aS,11aR)-5-hexyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol |
|---|---|
| PubChem CID | 134974553 |
| Molecular Formula | C25H46BNO3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | [(3R,5S,7R,7aS,11aR)-5-hexyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol |
| SMILES | CCCCCC[C@H]1C[C@@H](B2OC(C)(C)C(C)(C)O2)[C@@H]2CCCC[C@@]23CC[C@H](CO)N13 |
| InChI | InChI=1S/C25H46BNO3/c1-6-7-8-9-12-19-17-22(26-29-23(2,3)24(4,5)30-26)21-13-10-11-15-25(21)16-14-20(18-28)27(19)25/h19-22,28H,6-18H2,1-5H3/t19-,20+,21-,22+,25+/m0/s1 |
| InChIKey | XYBXBTQARWJRLD-ACRRGDEPSA-N |
| XLogP | 5.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|